C42H48O5 — CID 171356302
prop-2-ynyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxy-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate (PubChem CID 171356302) has the molecular formula C42H48O5 and a molecular weight of 632.84 g/mol. Its IUPAC name is prop-2-ynyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxy-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate.
| Compound Name | prop-2-ynyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxy-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
|---|---|
| PubChem CID | 171356302 |
| Molecular Formula | C42H48O5 |
| Molecular Weight | 632.84 g/mol |
| Exact Mass | 632.35 |
| IUPAC Name | prop-2-ynyl (2R,4aS,6aR,6aS,14aS,14bR)-2,4a,6a,6a,9,14a-hexamethyl-10-[(E)-3-(3-methylphenyl)prop-2-enoyl]oxy-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylate |
| SMILES | C#CCOC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(OC(=O)/C=C/c6cccc(C)c6)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C42H48O5/c1-9-23-46-37(45)39(5)18-17-38(4)19-21-41(7)33-15-14-30-28(3)36(47-35(44)16-13-29-12-10-11-27(2)24-29)32(43)25-31(30)40(33,6)20-22-42(41,8)34(38)26-39/h1,10-16,24-25,34H,17-23,26H2,2-8H3/b16-13+/t34-,38-,39-,40+,41-,42+/m1/s1 |
| InChIKey | ALMMHRLUNOQJPP-ZTTGVEBKSA-N |
| XLogP | 8.80 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.84 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|