C30H27Cl2N3O7 — CID 171356339
[1-[2-(3,4-dichlorophenyl)-2-oxoethyl]triazol-4-yl]methyl (E)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 171356339) has the molecular formula C30H27Cl2N3O7 and a molecular weight of 612.47 g/mol. Its IUPAC name is [1-[2-(3,4-dichlorophenyl)-2-oxoethyl]triazol-4-yl]methyl (E)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [1-[2-(3,4-dichlorophenyl)-2-oxoethyl]triazol-4-yl]methyl (E)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 171356339 |
| Molecular Formula | C30H27Cl2N3O7 |
| Molecular Weight | 612.47 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | [1-[2-(3,4-dichlorophenyl)-2-oxoethyl]triazol-4-yl]methyl (E)-2,3-bis(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C(/C(=O)OCc2cn(CC(=O)c3ccc(Cl)c(Cl)c3)nn2)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C30H27Cl2N3O7/c1-38-26-9-5-18(12-28(26)40-3)11-22(19-7-10-27(39-2)29(14-19)41-4)30(37)42-17-21-15-35(34-33-21)16-25(36)20-6-8-23(31)24(32)13-20/h5-15H,16-17H2,1-4H3/b22-11+ |
| InChIKey | LEKPMRUPYXSUCC-SSDVNMTOSA-N |
| XLogP | 5.79 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|