About 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine
4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine (PubChem CID 171356424) has the molecular formula C18H19NOS2
and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine.
Molecular Properties
| Compound Name | 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine |
| PubChem CID | 171356424 |
| Molecular Formula | C18H19NOS2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine |
| SMILES | c1cc(C2CCc3cc(C4SCCCS4)ccc3O2)ccn1 |
| InChI | InChI=1S/C18H19NOS2/c1-10-21-18(22-11-1)15-3-5-17-14(12-15)2-4-16(20-17)13-6-8-19-9-7-13/h3,5-9,12,16,18H,1-2,4,10-11H2 |
| InChIKey | XEIPCEZNFLBKDQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine?
The IUPAC name of 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine (CID 171356424) is 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine.
What is the SMILES notation for 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine?
The canonical SMILES for 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine is c1cc(C2CCc3cc(C4SCCCS4)ccc3O2)ccn1.
What is the InChIKey of 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine?
The InChIKey is XEIPCEZNFLBKDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NOS2/c1-10-21-18(22-11-1)15-3-5-17-14(12-15)2-4-16(20-17)13-6-8-19-9-7-13/h3,5-9,12,16,18H,1-2,4,10-11H2.
What are the key properties of 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine?
4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine has a molecular weight of 329.49 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(1,3-dithian-2-yl)-3,4-dihydro-2H-chromen-2-yl]pyridine is sourced from PubChem (CID 171356424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).