C21H18N2O4 — CID 171356648
(2S,4E)-2-(4-hydroxyphenyl)-4-(phenylhydrazinylidene)-2,3-dihydrochromene-5,7-diol (PubChem CID 171356648) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is (2S,4E)-2-(4-hydroxyphenyl)-4-(phenylhydrazinylidene)-2,3-dihydrochromene-5,7-diol.
| Compound Name | (2S,4E)-2-(4-hydroxyphenyl)-4-(phenylhydrazinylidene)-2,3-dihydrochromene-5,7-diol |
|---|---|
| PubChem CID | 171356648 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (2S,4E)-2-(4-hydroxyphenyl)-4-(phenylhydrazinylidene)-2,3-dihydrochromene-5,7-diol |
| SMILES | Oc1ccc([C@@H]2C/C(=N\Nc3ccccc3)c3c(O)cc(O)cc3O2)cc1 |
| InChI | InChI=1S/C21H18N2O4/c24-15-8-6-13(7-9-15)19-12-17(23-22-14-4-2-1-3-5-14)21-18(26)10-16(25)11-20(21)27-19/h1-11,19,22,24-26H,12H2/b23-17+/t19-/m0/s1 |
| InChIKey | JSXDKHOUGRXYDU-SNAUHIFDSA-N |
| XLogP | 4.14 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|