C15H26ClNO6S — CID 171356739
3-(3-chloropropylsulfonyl)-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane (PubChem CID 171356739) has the molecular formula C15H26ClNO6S and a molecular weight of 383.89 g/mol. Its IUPAC name is 3-(3-chloropropylsulfonyl)-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane.
| Compound Name | 3-(3-chloropropylsulfonyl)-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane |
|---|---|
| PubChem CID | 171356739 |
| Molecular Formula | C15H26ClNO6S |
| Molecular Weight | 383.89 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-(3-chloropropylsulfonyl)-7,8,16,17-tetraoxa-3-azadispiro[5.2.69.26]heptadecane |
| SMILES | O=S(=O)(CCCCl)N1CCC2(CC1)OOC1(CCCCCC1)OO2 |
| InChI | InChI=1S/C15H26ClNO6S/c16-10-5-13-24(18,19)17-11-8-15(9-12-17)22-20-14(21-23-15)6-3-1-2-4-7-14/h1-13H2 |
| InChIKey | XUNZCQOJMZMZOD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.89 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|