C22H24O11 — CID 171356992
1,2,6-trimethoxy-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one (PubChem CID 171356992) has the molecular formula C22H24O11 and a molecular weight of 464.42 g/mol. Its IUPAC name is 1,2,6-trimethoxy-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one.
| Compound Name | 1,2,6-trimethoxy-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
|---|---|
| PubChem CID | 171356992 |
| Molecular Formula | C22H24O11 |
| Molecular Weight | 464.42 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 1,2,6-trimethoxy-8-[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
| SMILES | COc1cc(O[C@H]2O[C@@H](CO)[C@H](O)[C@H](O)[C@@H]2O)c2c(=O)c3c(OC)c(OC)ccc3oc2c1 |
| InChI | InChI=1S/C22H24O11/c1-28-9-6-12-15(18(25)16-10(31-12)4-5-11(29-2)21(16)30-3)13(7-9)32-22-20(27)19(26)17(24)14(8-23)33-22/h4-7,14,17,19-20,22-24,26-27H,8H2,1-3H3/t14-,17-,19-,20-,22-/m0/s1 |
| InChIKey | PAYHXNIDUQPYRD-HRXUQERBSA-N |
| XLogP | 0.15 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|