C21H28O6 — CID 171357161
6-[(1E,3E,5E)-6-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]hexa-1,3,5-trienyl]-4-methoxy-3-methylpyran-2-one (PubChem CID 171357161) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is 6-[(1E,3E,5E)-6-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]hexa-1,3,5-trienyl]-4-methoxy-3-methylpyran-2-one.
| Compound Name | 6-[(1E,3E,5E)-6-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]hexa-1,3,5-trienyl]-4-methoxy-3-methylpyran-2-one |
|---|---|
| PubChem CID | 171357161 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 6-[(1E,3E,5E)-6-[(2S,3S,4S,5S)-5-ethyl-3,4-dihydroxy-2,4-dimethyloxolan-2-yl]hexa-1,3,5-trienyl]-4-methoxy-3-methylpyran-2-one |
| SMILES | CC[C@@H]1O[C@@](C)(/C=C/C=C/C=C/c2cc(OC)c(C)c(=O)o2)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C21H28O6/c1-6-17-21(4,24)19(23)20(3,27-17)12-10-8-7-9-11-15-13-16(25-5)14(2)18(22)26-15/h7-13,17,19,23-24H,6H2,1-5H3/b8-7+,11-9+,12-10+/t17-,19+,20-,21+/m0/s1 |
| InChIKey | OWLCPBOTEBUBMU-FECUWFNLSA-N |
| XLogP | 2.76 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|