About 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione
2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione (PubChem CID 171357253) has the molecular formula C17H24N6O5S
and a molecular weight of 424.48 g/mol. Its IUPAC name is 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione.
Molecular Properties
| Compound Name | 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione |
| PubChem CID | 171357253 |
| Molecular Formula | C17H24N6O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione |
| SMILES | CS(=O)(=O)N1CCC(Nc2ncc3[nH]c(=O)c(=O)n(C4CCOCC4)c3n2)CC1 |
| InChI | InChI=1S/C17H24N6O5S/c1-29(26,27)22-6-2-11(3-7-22)19-17-18-10-13-14(21-17)23(16(25)15(24)20-13)12-4-8-28-9-5-12/h10-12H,2-9H2,1H3,(H,20,24)(H,18,19,21) |
| InChIKey | VRRQWELYQUSSNV-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione?
The IUPAC name of 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione (CID 171357253) is 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione.
What is the SMILES notation for 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione?
The canonical SMILES for 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione is CS(=O)(=O)N1CCC(Nc2ncc3[nH]c(=O)c(=O)n(C4CCOCC4)c3n2)CC1.
What is the InChIKey of 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione?
The InChIKey is VRRQWELYQUSSNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N6O5S/c1-29(26,27)22-6-2-11(3-7-22)19-17-18-10-13-14(21-17)23(16(25)15(24)20-13)12-4-8-28-9-5-12/h10-12H,2-9H2,1H3,(H,20,24)(H,18,19,21).
What are the key properties of 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione?
2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione has a molecular weight of 424.48 g/mol, XLogP of -0.33, 4 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methylsulfonylpiperidin-4-yl)amino]-8-(oxan-4-yl)-5H-pteridine-6,7-dione is sourced from PubChem (CID 171357253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).