C29H29BCl2FN5O5 — CID 171357353
[4-[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamoyloxymethyl]phenyl]boronic acid (PubChem CID 171357353) has the molecular formula C29H29BCl2FN5O5 and a molecular weight of 628.30 g/mol. Its IUPAC name is [4-[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamoyloxymethyl]phenyl]boronic acid.
| Compound Name | [4-[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamoyloxymethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 171357353 |
| Molecular Formula | C29H29BCl2FN5O5 |
| Molecular Weight | 628.30 g/mol |
| Exact Mass | 627.16 |
| IUPAC Name | [4-[[3-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(1-piperidin-4-ylpyrazol-4-yl)-2-pyridinyl]carbamoyloxymethyl]phenyl]boronic acid |
| SMILES | C[C@@H](Oc1cc(-c2cnn(C3CCNCC3)c2)cnc1NC(=O)OCc1ccc(B(O)O)cc1)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C29H29BCl2FN5O5/c1-17(26-23(31)6-7-24(33)27(26)32)43-25-12-19(20-14-36-38(15-20)22-8-10-34-11-9-22)13-35-28(25)37-29(39)42-16-18-2-4-21(5-3-18)30(40)41/h2-7,12-15,17,22,34,40-41H,8-11,16H2,1H3,(H,35,37,39)/t17-/m1/s1 |
| InChIKey | XIDQHQDOVAVPEC-QGZVFWFLSA-N |
| XLogP | 4.88 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|