C26H29ClN2O — CID 171357416
(11R,12R,13R,15R,16R)-13-chloro-12-ethenyl-16-hydroxy-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9-pentaene-11-carbonitrile (PubChem CID 171357416) has the molecular formula C26H29ClN2O and a molecular weight of 420.98 g/mol. Its IUPAC name is (11R,12R,13R,15R,16R)-13-chloro-12-ethenyl-16-hydroxy-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9-pentaene-11-carbonitrile.
| Compound Name | (11R,12R,13R,15R,16R)-13-chloro-12-ethenyl-16-hydroxy-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9-pentaene-11-carbonitrile |
|---|---|
| PubChem CID | 171357416 |
| Molecular Formula | C26H29ClN2O |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (11R,12R,13R,15R,16R)-13-chloro-12-ethenyl-16-hydroxy-8,8,12,19,19-pentamethyl-6-azapentacyclo[13.3.1.05,18.07,17.011,16]nonadeca-1(18),2,4,7(17),9-pentaene-11-carbonitrile |
| SMILES | C=C[C@@]1(C)[C@H](Cl)C[C@@H]2C(C)(C)c3cccc4[nH]c5c(c34)[C@@]2(O)[C@]1(C#N)C=CC5(C)C |
| InChI | InChI=1S/C26H29ClN2O/c1-7-24(6)18(27)13-17-23(4,5)15-9-8-10-16-19(15)20-21(29-16)22(2,3)11-12-25(24,14-28)26(17,20)30/h7-12,17-18,29-30H,1,13H2,2-6H3/t17-,18-,24+,25+,26-/m1/s1 |
| InChIKey | NVJYFLIGJIVBHY-OWINPNOJSA-N |
| XLogP | 5.82 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|