C30H47NO4S — CID 171357528
[(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]sulfanyl]acetate (PubChem CID 171357528) has the molecular formula C30H47NO4S and a molecular weight of 517.78 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]sulfanyl]acetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 171357528 |
| Molecular Formula | C30H47NO4S |
| Molecular Weight | 517.78 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[[(2R)-8-methyl-8-azabicyclo[3.2.1]octan-2-yl]sulfanyl]acetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CS[C@@H]2CCC3CCC2N3C)[C@@]2(C)C3C(=O)CC[C@@]3(CC[C@H]2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C30H47NO4S/c1-7-28(4)16-24(35-25(33)17-36-23-11-9-20-8-10-21(23)31(20)6)29(5)18(2)12-14-30(19(3)27(28)34)15-13-22(32)26(29)30/h7,18-21,23-24,26-27,34H,1,8-17H2,2-6H3/t18-,19+,20?,21?,23-,24-,26?,27+,28-,29+,30+/m1/s1 |
| InChIKey | XPDWSVPFMYOLIJ-MOLMKHOXSA-N |
| XLogP | 5.25 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.78 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|