C19H18O4 — CID 171357605
(2Z)-7,7-dimethyl-2-[(5-methylfuran-2-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-3-one (PubChem CID 171357605) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2Z)-7,7-dimethyl-2-[(5-methylfuran-2-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-3-one.
| Compound Name | (2Z)-7,7-dimethyl-2-[(5-methylfuran-2-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-3-one |
|---|---|
| PubChem CID | 171357605 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (2Z)-7,7-dimethyl-2-[(5-methylfuran-2-yl)methylidene]-8,9-dihydrofuro[2,3-f]chromen-3-one |
| SMILES | Cc1ccc(/C=C2\Oc3c(ccc4c3CCC(C)(C)O4)C2=O)o1 |
| InChI | InChI=1S/C19H18O4/c1-11-4-5-12(21-11)10-16-17(20)14-6-7-15-13(18(14)22-16)8-9-19(2,3)23-15/h4-7,10H,8-9H2,1-3H3/b16-10- |
| InChIKey | XSJPVULRHKDSHA-YBEGLDIGSA-N |
| XLogP | 4.31 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|