C20H15NO9 — CID 171357714
[4-[(3,4,5-trihydroxybenzoyl)amino]phenyl] 3,4,5-trihydroxybenzoate (PubChem CID 171357714) has the molecular formula C20H15NO9 and a molecular weight of 413.34 g/mol. Its IUPAC name is [4-[(3,4,5-trihydroxybenzoyl)amino]phenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4-[(3,4,5-trihydroxybenzoyl)amino]phenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 171357714 |
| Molecular Formula | C20H15NO9 |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | [4-[(3,4,5-trihydroxybenzoyl)amino]phenyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Nc1ccc(OC(=O)c2cc(O)c(O)c(O)c2)cc1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C20H15NO9/c22-13-5-9(6-14(23)17(13)26)19(28)21-11-1-3-12(4-2-11)30-20(29)10-7-15(24)18(27)16(25)8-10/h1-8,22-27H,(H,21,28) |
| InChIKey | OHNOGBYRNLESQD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 176.78 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|