C14H20Cl2N2O4S2 — CID 171357752
N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]butane-1,4-diamine (PubChem CID 171357752) has the molecular formula C14H20Cl2N2O4S2 and a molecular weight of 415.36 g/mol. Its IUPAC name is N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]butane-1,4-diamine.
| Compound Name | N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 171357752 |
| Molecular Formula | C14H20Cl2N2O4S2 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]butane-1,4-diamine |
| SMILES | NCCCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O4S2/c15-11-4-3-10(7-12(11)16)24(21,22)14-9-23(19,20)8-13(14)18-6-2-1-5-17/h3-4,7,13-14,18H,1-2,5-6,8-9,17H2/t13-,14-/m0/s1 |
| InChIKey | JZVLLOIJUQAHSL-KBPBESRZSA-N |
| XLogP | 1.26 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|