C31H40N2O3 — CID 171357817
(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 171357817) has the molecular formula C31H40N2O3 and a molecular weight of 488.67 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 171357817 |
| Molecular Formula | C31H40N2O3 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-N-[2-[[(E)-3-phenylprop-2-enoyl]amino]ethyl]-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)NCCNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C31H40N2O3/c1-30-16-14-23(34)20-22(30)9-10-24-25-11-12-27(31(25,2)17-15-26(24)30)29(36)33-19-18-32-28(35)13-8-21-6-4-3-5-7-21/h3-8,13,20,24-27H,9-12,14-19H2,1-2H3,(H,32,35)(H,33,36)/b13-8+/t24-,25-,26-,27+,30-,31-/m0/s1 |
| InChIKey | XMMDENZVHFFUTK-LLWYYCQTSA-N |
| XLogP | 5.08 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|