C34H39NO5 — CID 171357936
[(4R,5S)-2,5-dimethyl-4-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-5-(4-methylpent-3-enyl)-4,6-dihydrocyclohepta[b]furan-8-yl]methyl 1H-indole-6-carboxylate (PubChem CID 171357936) has the molecular formula C34H39NO5 and a molecular weight of 541.69 g/mol. Its IUPAC name is [(4R,5S)-2,5-dimethyl-4-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-5-(4-methylpent-3-enyl)-4,6-dihydrocyclohepta[b]furan-8-yl]methyl 1H-indole-6-carboxylate.
| Compound Name | [(4R,5S)-2,5-dimethyl-4-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-5-(4-methylpent-3-enyl)-4,6-dihydrocyclohepta[b]furan-8-yl]methyl 1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 171357936 |
| Molecular Formula | C34H39NO5 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | [(4R,5S)-2,5-dimethyl-4-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-5-(4-methylpent-3-enyl)-4,6-dihydrocyclohepta[b]furan-8-yl]methyl 1H-indole-6-carboxylate |
| SMILES | CC(C)=CCC[C@@]1(C)CC=C(COC(=O)c2ccc3cc[nH]c3c2)c2oc(C)cc2[C@@H]1/C=C/OC(=O)C=C(C)C |
| InChI | InChI=1S/C34H39NO5/c1-22(2)8-7-14-34(6)15-11-27(21-39-33(37)26-10-9-25-12-16-35-30(25)20-26)32-28(19-24(5)40-32)29(34)13-17-38-31(36)18-23(3)4/h8-13,16-20,29,35H,7,14-15,21H2,1-6H3/b17-13+/t29-,34-/m0/s1 |
| InChIKey | OJNANJLQBIOJNC-OGDPBZEKSA-N |
| XLogP | 8.57 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|