About N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide
N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide (PubChem CID 171357971) has the molecular formula C15H19N3O3S
and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 171357971 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide |
| SMILES | CC[C@@](NC(=O)c1csc(-c2ccoc2)n1)(C(N)=O)C(C)C |
| InChI | InChI=1S/C15H19N3O3S/c1-4-15(9(2)3,14(16)20)18-12(19)11-8-22-13(17-11)10-5-6-21-7-10/h5-9H,4H2,1-3H3,(H2,16,20)(H,18,19)/t15-/m0/s1 |
| InChIKey | QMRYTJPWUAWXCS-HNNXBMFYSA-N |
| XLogP | 2.42 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide (CID 171357971) is N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide is CC[C@@](NC(=O)c1csc(-c2ccoc2)n1)(C(N)=O)C(C)C.
What is the InChIKey of N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide?
The InChIKey is QMRYTJPWUAWXCS-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H19N3O3S/c1-4-15(9(2)3,14(16)20)18-12(19)11-8-22-13(17-11)10-5-6-21-7-10/h5-9H,4H2,1-3H3,(H2,16,20)(H,18,19)/t15-/m0/s1.
What are the key properties of N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide?
N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide has a molecular weight of 321.40 g/mol, XLogP of 2.42, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-3-carbamoyl-2-methylpentan-3-yl]-2-(furan-3-yl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 171357971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).