C21H24N8O2S — CID 171358152
(2S)-2-[bis(1H-imidazol-2-ylmethyl)amino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid (PubChem CID 171358152) has the molecular formula C21H24N8O2S and a molecular weight of 452.54 g/mol. Its IUPAC name is (2S)-2-[bis(1H-imidazol-2-ylmethyl)amino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid.
| Compound Name | (2S)-2-[bis(1H-imidazol-2-ylmethyl)amino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid |
|---|---|
| PubChem CID | 171358152 |
| Molecular Formula | C21H24N8O2S |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (2S)-2-[bis(1H-imidazol-2-ylmethyl)amino]-5-(3-phenyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)pentanoic acid |
| SMILES | O=C(O)[C@H](CCCn1c(-c2ccccc2)n[nH]c1=S)N(Cc1ncc[nH]1)Cc1ncc[nH]1 |
| InChI | InChI=1S/C21H24N8O2S/c30-20(31)16(28(13-17-22-8-9-23-17)14-18-24-10-11-25-18)7-4-12-29-19(26-27-21(29)32)15-5-2-1-3-6-15/h1-3,5-6,8-11,16H,4,7,12-14H2,(H,22,23)(H,24,25)(H,27,32)(H,30,31)/t16-/m0/s1 |
| InChIKey | IPOFFJDFWWMHOA-INIZCTEOSA-N |
| XLogP | 2.99 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|