C20H26O3 — CID 171358211
3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 171358211) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 171358211 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 3-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenyl]-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | C=C(c1ccc2c(c1)CCCC2)C1COC2(CCCCC2)OO1 |
| InChI | InChI=1S/C20H26O3/c1-15(17-10-9-16-7-3-4-8-18(16)13-17)19-14-21-20(23-22-19)11-5-2-6-12-20/h9-10,13,19H,1-8,11-12,14H2 |
| InChIKey | ICDHZRBKSNZQJL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|