C27H29N3O4S — CID 171358394
N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]pyridine-3-carboxamide (PubChem CID 171358394) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]pyridine-3-carboxamide.
| Compound Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171358394 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[3-(6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbonyl)-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl]pyridine-3-carboxamide |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)c1c(NC(=O)c3cccnc3)sc3c1CCCCC3)CC2 |
| InChI | InChI=1S/C27H29N3O4S/c1-33-21-13-17-10-12-30(16-19(17)14-22(21)34-2)27(32)24-20-8-4-3-5-9-23(20)35-26(24)29-25(31)18-7-6-11-28-15-18/h6-7,11,13-15H,3-5,8-10,12,16H2,1-2H3,(H,29,31) |
| InChIKey | VAANVJIOOUEZFS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |