C25H20ClFN2O3 — CID 171358453
(2-fluorophenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 171358453) has the molecular formula C25H20ClFN2O3 and a molecular weight of 450.90 g/mol. Its IUPAC name is (2-fluorophenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (2-fluorophenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 171358453 |
| Molecular Formula | C25H20ClFN2O3 |
| Molecular Weight | 450.90 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | (2-fluorophenyl) 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H20ClFN2O3/c1-31-17-9-6-15(7-10-17)24-23-18(19-14-16(26)8-11-21(19)28-23)12-13-29(24)25(30)32-22-5-3-2-4-20(22)27/h2-11,14,24,28H,12-13H2,1H3 |
| InChIKey | VUQUKEORJRTWGL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.90 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|