C28H39F3N2O4 — CID 171358460
1-[4-(trifluoromethyl)phenyl]-4-[2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]piperazine (PubChem CID 171358460) has the molecular formula C28H39F3N2O4 and a molecular weight of 524.62 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-4-[2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]piperazine.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-4-[2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]piperazine |
|---|---|
| PubChem CID | 171358460 |
| Molecular Formula | C28H39F3N2O4 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-4-[2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]ethyl]piperazine |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(CCN3CCN(c4ccc(C(F)(F)F)cc4)CC3)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C28H39F3N2O4/c1-18-4-9-23-19(2)24(34-25-27(23)22(18)10-12-26(3,35-25)36-37-27)11-13-32-14-16-33(17-15-32)21-7-5-20(6-8-21)28(29,30)31/h5-8,18-19,22-25H,4,9-17H2,1-3H3/t18-,19-,22+,23+,24?,25-,26+,27-/m1/s1 |
| InChIKey | COIYXYFDFCPMGE-QNIYQZFZSA-N |
| XLogP | 5.47 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|