About [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate
[4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate (PubChem CID 171358569) has the molecular formula C24H25NO6
and a molecular weight of 423.47 g/mol. Its IUPAC name is [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate.
Molecular Properties
| Compound Name | [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate |
| PubChem CID | 171358569 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate |
| SMILES | COc1ccc(CCc2cc(OC)c(OC(=O)c3ccccn3)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H25NO6/c1-27-19-11-10-16(13-20(19)28-2)8-9-17-14-21(29-3)23(22(15-17)30-4)31-24(26)18-7-5-6-12-25-18/h5-7,10-15H,8-9H2,1-4H3 |
| InChIKey | OABCGUSTZNHRLK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate?
The IUPAC name of [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate (CID 171358569) is [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate.
What is the SMILES notation for [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate?
The canonical SMILES for [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate is COc1ccc(CCc2cc(OC)c(OC(=O)c3ccccn3)c(OC)c2)cc1OC.
What is the InChIKey of [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate?
The InChIKey is OABCGUSTZNHRLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25NO6/c1-27-19-11-10-16(13-20(19)28-2)8-9-17-14-21(29-3)23(22(15-17)30-4)31-24(26)18-7-5-6-12-25-18/h5-7,10-15H,8-9H2,1-4H3.
What are the key properties of [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate?
[4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate has a molecular weight of 423.47 g/mol, XLogP of 4.12, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(3,4-dimethoxyphenyl)ethyl]-2,6-dimethoxyphenyl] pyridine-2-carboxylate is sourced from PubChem (CID 171358569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).