C22H23N5O4 — CID 171358715
3-(3-amino-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine (PubChem CID 171358715) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 3-(3-amino-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine.
| Compound Name | 3-(3-amino-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
|---|---|
| PubChem CID | 171358715 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 3-(3-amino-4-methoxyphenyl)-N-(3,4,5-trimethoxyphenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-amine |
| SMILES | COc1ccc(-c2nnc3ccc(Nc4cc(OC)c(OC)c(OC)c4)cn23)cc1N |
| InChI | InChI=1S/C22H23N5O4/c1-28-17-7-5-13(9-16(17)23)22-26-25-20-8-6-14(12-27(20)22)24-15-10-18(29-2)21(31-4)19(11-15)30-3/h5-12,24H,23H2,1-4H3 |
| InChIKey | FKQDXFDVQQLKNQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|