C23H19ClN4O3 — CID 171358840
pyrimidin-5-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 171358840) has the molecular formula C23H19ClN4O3 and a molecular weight of 434.88 g/mol. Its IUPAC name is pyrimidin-5-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | pyrimidin-5-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 171358840 |
| Molecular Formula | C23H19ClN4O3 |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | pyrimidin-5-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2cncnc2)cc1 |
| InChI | InChI=1S/C23H19ClN4O3/c1-30-16-5-2-14(3-6-16)22-21-18(19-10-15(24)4-7-20(19)27-21)8-9-28(22)23(29)31-17-11-25-13-26-12-17/h2-7,10-13,22,27H,8-9H2,1H3 |
| InChIKey | VGFZDUZYYYUYOY-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|