About N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine
N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 171358912) has the molecular formula C14H21F2N5O
and a molecular weight of 313.35 g/mol. Its IUPAC name is N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine |
| PubChem CID | 171358912 |
| Molecular Formula | C14H21F2N5O |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | FC1(F)CNCC[C@@H]1CNc1cc(N2CCOCC2)ncn1 |
| InChI | InChI=1S/C14H21F2N5O/c15-14(16)9-17-2-1-11(14)8-18-12-7-13(20-10-19-12)21-3-5-22-6-4-21/h7,10-11,17H,1-6,8-9H2,(H,18,19,20)/t11-/m1/s1 |
| InChIKey | LWAGRPUXVCNZPL-LLVKDONJSA-N |
| XLogP | 0.97 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine?
The IUPAC name of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine (CID 171358912) is N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine.
What is the SMILES notation for N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine?
The canonical SMILES for N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine is FC1(F)CNCC[C@@H]1CNc1cc(N2CCOCC2)ncn1.
What is the InChIKey of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine?
The InChIKey is LWAGRPUXVCNZPL-LLVKDONJSA-N. The full InChI is InChI=1S/C14H21F2N5O/c15-14(16)9-17-2-1-11(14)8-18-12-7-13(20-10-19-12)21-3-5-22-6-4-21/h7,10-11,17H,1-6,8-9H2,(H,18,19,20)/t11-/m1/s1.
What are the key properties of N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine?
N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine has a molecular weight of 313.35 g/mol, XLogP of 0.97, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(4R)-3,3-difluoropiperidin-4-yl]methyl]-6-morpholin-4-ylpyrimidin-4-amine is sourced from PubChem (CID 171358912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).