About (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one
(5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one (PubChem CID 171358977) has the molecular formula C18H33N3O
and a molecular weight of 307.48 g/mol. Its IUPAC name is (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one |
| PubChem CID | 171358977 |
| Molecular Formula | C18H33N3O |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.26 |
| IUPAC Name | (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one |
| SMILES | CN1C[C@@H](CN2CCCN(C3CCCCC3)CC2)CCC1=O |
| InChI | InChI=1S/C18H33N3O/c1-19-14-16(8-9-18(19)22)15-20-10-5-11-21(13-12-20)17-6-3-2-4-7-17/h16-17H,2-15H2,1H3/t16-/m0/s1 |
| InChIKey | RKSATBAZFAVFJD-INIZCTEOSA-N |
| XLogP | 2.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one?
The IUPAC name of (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one (CID 171358977) is (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one.
What is the SMILES notation for (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one?
The canonical SMILES for (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one is CN1C[C@@H](CN2CCCN(C3CCCCC3)CC2)CCC1=O.
What is the InChIKey of (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one?
The InChIKey is RKSATBAZFAVFJD-INIZCTEOSA-N. The full InChI is InChI=1S/C18H33N3O/c1-19-14-16(8-9-18(19)22)15-20-10-5-11-21(13-12-20)17-6-3-2-4-7-17/h16-17H,2-15H2,1H3/t16-/m0/s1.
What are the key properties of (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one?
(5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one has a molecular weight of 307.48 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-[(4-cyclohexyl-1,4-diazepan-1-yl)methyl]-1-methylpiperidin-2-one is sourced from PubChem (CID 171358977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).