About 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone
3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone (PubChem CID 171359166) has the molecular formula C21H26N4O3
and a molecular weight of 382.46 g/mol. Its IUPAC name is 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone.
Molecular Properties
| Compound Name | 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone |
| PubChem CID | 171359166 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone |
| SMILES | O=C(c1c(N2CCOCC2)noc1-c1ccccc1)N1CC2CCC(C1)NC2 |
| InChI | InChI=1S/C21H26N4O3/c26-21(25-13-15-6-7-17(14-25)22-12-15)18-19(16-4-2-1-3-5-16)28-23-20(18)24-8-10-27-11-9-24/h1-5,15,17,22H,6-14H2 |
| InChIKey | VQUALGSTZNALJO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 70.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone?
The IUPAC name of 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone (CID 171359166) is 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone.
What is the SMILES notation for 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone?
The canonical SMILES for 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone is O=C(c1c(N2CCOCC2)noc1-c1ccccc1)N1CC2CCC(C1)NC2.
What is the InChIKey of 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone?
The InChIKey is VQUALGSTZNALJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26N4O3/c26-21(25-13-15-6-7-17(14-25)22-12-15)18-19(16-4-2-1-3-5-16)28-23-20(18)24-8-10-27-11-9-24/h1-5,15,17,22H,6-14H2.
What are the key properties of 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone?
3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone has a molecular weight of 382.46 g/mol, XLogP of 2.00, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diazabicyclo[3.2.2]nonan-3-yl-(3-morpholin-4-yl-5-phenyl-1,2-oxazol-4-yl)methanone is sourced from PubChem (CID 171359166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).