C21H21N5O2 — CID 171359273
3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl-[3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]methanone (PubChem CID 171359273) has the molecular formula C21H21N5O2 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl-[3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]methanone.
| Compound Name | 3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl-[3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]methanone |
|---|---|
| PubChem CID | 171359273 |
| Molecular Formula | C21H21N5O2 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl-[3-[5-(3-methyl-1,2,4-oxadiazol-5-yl)-2-pyridinyl]phenyl]methanone |
| SMILES | Cc1noc(-c2ccc(-c3cccc(C(=O)N4CCC5CNCC54)c3)nc2)n1 |
| InChI | InChI=1S/C21H21N5O2/c1-13-24-20(28-25-13)17-5-6-18(23-11-17)14-3-2-4-15(9-14)21(27)26-8-7-16-10-22-12-19(16)26/h2-6,9,11,16,19,22H,7-8,10,12H2,1H3 |
| InChIKey | CUJNLODNOWWCLP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |