About (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid
(2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid (PubChem CID 171359374) has the molecular formula C20H18N2O5
and a molecular weight of 366.37 g/mol. Its IUPAC name is (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid.
Molecular Properties
| Compound Name | (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid |
| PubChem CID | 171359374 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid |
| SMILES | O=C(CN1Cc2ccccc2C1=O)N[C@@H](C(=O)O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C20H18N2O5/c23-17(11-22-10-14-3-1-2-4-15(14)19(22)24)21-18(20(25)26)13-5-6-16-12(9-13)7-8-27-16/h1-6,9,18H,7-8,10-11H2,(H,21,23)(H,25,26)/t18-/m1/s1 |
| InChIKey | UGEVNKBUFMYAAE-GOSISDBHSA-N |
| XLogP | 1.52 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid?
The IUPAC name of (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid (CID 171359374) is (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid.
What is the SMILES notation for (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid?
The canonical SMILES for (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid is O=C(CN1Cc2ccccc2C1=O)N[C@@H](C(=O)O)c1ccc2c(c1)CCO2.
What is the InChIKey of (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid?
The InChIKey is UGEVNKBUFMYAAE-GOSISDBHSA-N. The full InChI is InChI=1S/C20H18N2O5/c23-17(11-22-10-14-3-1-2-4-15(14)19(22)24)21-18(20(25)26)13-5-6-16-12(9-13)7-8-27-16/h1-6,9,18H,7-8,10-11H2,(H,21,23)(H,25,26)/t18-/m1/s1.
What are the key properties of (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid?
(2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid has a molecular weight of 366.37 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,3-dihydro-1-benzofuran-5-yl)-2-[[2-(3-oxo-1H-isoindol-2-yl)acetyl]amino]acetic acid is sourced from PubChem (CID 171359374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).