C20H25FN2O — CID 171359477
(2R)-2-[3-[2-fluoro-5-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-2-(methylamino)ethanol (PubChem CID 171359477) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is (2R)-2-[3-[2-fluoro-5-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-2-(methylamino)ethanol.
| Compound Name | (2R)-2-[3-[2-fluoro-5-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 171359477 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (2R)-2-[3-[2-fluoro-5-(pyrrolidin-1-ylmethyl)phenyl]phenyl]-2-(methylamino)ethanol |
| SMILES | CN[C@@H](CO)c1cccc(-c2cc(CN3CCCC3)ccc2F)c1 |
| InChI | InChI=1S/C20H25FN2O/c1-22-20(14-24)17-6-4-5-16(12-17)18-11-15(7-8-19(18)21)13-23-9-2-3-10-23/h4-8,11-12,20,22,24H,2-3,9-10,13-14H2,1H3/t20-/m0/s1 |
| InChIKey | ZWXCDGLKRLFHEF-FQEVSTJZSA-N |
| XLogP | 3.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |