C22H27N3O3 — CID 171359578
1-[3,5-dimethyl-4-(4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-1H-pyrrol-2-yl]ethanone (PubChem CID 171359578) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-(4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-1H-pyrrol-2-yl]ethanone.
| Compound Name | 1-[3,5-dimethyl-4-(4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-1H-pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 171359578 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 1-[3,5-dimethyl-4-(4-phenyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carbonyl)-1H-pyrrol-2-yl]ethanone |
| SMILES | CC(=O)c1[nH]c(C)c(C(=O)N2CCN3C(COCC3c3ccccc3)C2)c1C |
| InChI | InChI=1S/C22H27N3O3/c1-14-20(15(2)23-21(14)16(3)26)22(27)24-9-10-25-18(11-24)12-28-13-19(25)17-7-5-4-6-8-17/h4-8,18-19,23H,9-13H2,1-3H3 |
| InChIKey | IOLYVYCPVARTGS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |