C23H29N3O3 — CID 171359583
N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-4-carboxamide (PubChem CID 171359583) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-4-carboxamide.
| Compound Name | N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171359583 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | N-[(2-methoxy-4,6-dimethyl-3-pyridinyl)methyl]-2-phenyl-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-4-carboxamide |
| SMILES | COc1nc(C)cc(C)c1CNC(=O)N1CCCC2OC(c3ccccc3)CC21 |
| InChI | InChI=1S/C23H29N3O3/c1-15-12-16(2)25-22(28-3)18(15)14-24-23(27)26-11-7-10-20-19(26)13-21(29-20)17-8-5-4-6-9-17/h4-6,8-9,12,19-21H,7,10-11,13-14H2,1-3H3,(H,24,27) |
| InChIKey | YRUUNADMXWFMKK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |