About 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea
1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea (PubChem CID 171359661) has the molecular formula C15H16N4O4S
and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea |
| PubChem CID | 171359661 |
| Molecular Formula | C15H16N4O4S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea |
| SMILES | COc1cnc(NC(=O)NCC[C@@]2(O)C(=O)Nc3ccccc32)s1 |
| InChI | InChI=1S/C15H16N4O4S/c1-23-11-8-17-14(24-11)19-13(21)16-7-6-15(22)9-4-2-3-5-10(9)18-12(15)20/h2-5,8,22H,6-7H2,1H3,(H,18,20)(H2,16,17,19,21)/t15-/m0/s1 |
| InChIKey | JILCOBLJDZUQMR-HNNXBMFYSA-N |
| XLogP | 1.50 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea?
The IUPAC name of 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea (CID 171359661) is 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea.
What is the SMILES notation for 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea?
The canonical SMILES for 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea is COc1cnc(NC(=O)NCC[C@@]2(O)C(=O)Nc3ccccc32)s1.
What is the InChIKey of 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea?
The InChIKey is JILCOBLJDZUQMR-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H16N4O4S/c1-23-11-8-17-14(24-11)19-13(21)16-7-6-15(22)9-4-2-3-5-10(9)18-12(15)20/h2-5,8,22H,6-7H2,1H3,(H,18,20)(H2,16,17,19,21)/t15-/m0/s1.
What are the key properties of 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea?
1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea has a molecular weight of 348.38 g/mol, XLogP of 1.50, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3S)-3-hydroxy-2-oxo-1H-indol-3-yl]ethyl]-3-(5-methoxy-1,3-thiazol-2-yl)urea is sourced from PubChem (CID 171359661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).