C16H24N6 — CID 171359816
4-amino-2-[[(3R)-1-cyclopentylpiperidin-3-yl]methylamino]pyrimidine-5-carbonitrile (PubChem CID 171359816) has the molecular formula C16H24N6 and a molecular weight of 300.41 g/mol. Its IUPAC name is 4-amino-2-[[(3R)-1-cyclopentylpiperidin-3-yl]methylamino]pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-[[(3R)-1-cyclopentylpiperidin-3-yl]methylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 171359816 |
| Molecular Formula | C16H24N6 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 4-amino-2-[[(3R)-1-cyclopentylpiperidin-3-yl]methylamino]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1cnc(NC[C@H]2CCCN(C3CCCC3)C2)nc1N |
| InChI | InChI=1S/C16H24N6/c17-8-13-10-20-16(21-15(13)18)19-9-12-4-3-7-22(11-12)14-5-1-2-6-14/h10,12,14H,1-7,9,11H2,(H3,18,19,20,21)/t12-/m1/s1 |
| InChIKey | ATJWTPKPGPXJJF-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |