About N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine
N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 171359849) has the molecular formula C14H23N5O
and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine |
| PubChem CID | 171359849 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | c1nc(NC[C@H]2CNCCCO2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C14H23N5O/c1-2-6-19(5-1)14-8-13(17-11-18-14)16-10-12-9-15-4-3-7-20-12/h8,11-12,15H,1-7,9-10H2,(H,16,17,18)/t12-/m1/s1 |
| InChIKey | FVYFYDBDBGXPAW-GFCCVEGCSA-N |
| XLogP | 0.87 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine?
The IUPAC name of N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine (CID 171359849) is N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine.
What is the SMILES notation for N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine?
The canonical SMILES for N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine is c1nc(NC[C@H]2CNCCCO2)cc(N2CCCC2)n1.
What is the InChIKey of N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine?
The InChIKey is FVYFYDBDBGXPAW-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H23N5O/c1-2-6-19(5-1)14-8-13(17-11-18-14)16-10-12-9-15-4-3-7-20-12/h8,11-12,15H,1-7,9-10H2,(H,16,17,18)/t12-/m1/s1.
What are the key properties of N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine?
N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine has a molecular weight of 277.37 g/mol, XLogP of 0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R)-1,4-oxazepan-2-yl]methyl]-6-pyrrolidin-1-ylpyrimidin-4-amine is sourced from PubChem (CID 171359849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).