C20H29NO4 — CID 171359967
1-methyl-2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrole (PubChem CID 171359967) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-methyl-2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrole.
| Compound Name | 1-methyl-2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrole |
|---|---|
| PubChem CID | 171359967 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 1-methyl-2-[(1S,4S,5R,8S,9R,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]pyrrole |
| SMILES | C[C@@H]1CC[C@H]2[C@@H](C)C(c3cccn3C)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C20H29NO4/c1-12-7-8-15-13(2)17(16-6-5-11-21(16)4)22-18-20(15)14(12)9-10-19(3,23-18)24-25-20/h5-6,11-15,17-18H,7-10H2,1-4H3/t12-,13-,14+,15+,17?,18-,19+,20-/m1/s1 |
| InChIKey | GKPMNMIGONGFPL-NFFXYCNNSA-N |
| XLogP | 3.95 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|