About N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide
N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide (PubChem CID 171360559) has the molecular formula C22H28N2O3Si2
and a molecular weight of 424.65 g/mol. Its IUPAC name is N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide |
| PubChem CID | 171360559 |
| Molecular Formula | C22H28N2O3Si2 |
| Molecular Weight | 424.65 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide |
| SMILES | C[Si](C)(C)c1cc([Si](C)(C)C)c(NC(=O)C2C=Nc3ccccc3C2=O)cc1O |
| InChI | InChI=1S/C22H28N2O3Si2/c1-28(2,3)19-12-20(29(4,5)6)18(25)11-17(19)24-22(27)15-13-23-16-10-8-7-9-14(16)21(15)26/h7-13,15,25H,1-6H3,(H,24,27) |
| InChIKey | UEVRLFRWCSFPGU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.65 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide?
The IUPAC name of N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide (CID 171360559) is N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide.
What is the SMILES notation for N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide?
The canonical SMILES for N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide is C[Si](C)(C)c1cc([Si](C)(C)C)c(NC(=O)C2C=Nc3ccccc3C2=O)cc1O.
What is the InChIKey of N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide?
The InChIKey is UEVRLFRWCSFPGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O3Si2/c1-28(2,3)19-12-20(29(4,5)6)18(25)11-17(19)24-22(27)15-13-23-16-10-8-7-9-14(16)21(15)26/h7-13,15,25H,1-6H3,(H,24,27).
What are the key properties of N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide?
N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide has a molecular weight of 424.65 g/mol, XLogP of 3.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-hydroxy-2,4-bis(trimethylsilyl)phenyl]-4-oxo-3H-quinoline-3-carboxamide is sourced from PubChem (CID 171360559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).