C24H44F3N3O7 — CID 171360871
(3R,4R,5S)-4-[[(2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 171360871) has the molecular formula C24H44F3N3O7 and a molecular weight of 543.62 g/mol. Its IUPAC name is (3R,4R,5S)-4-[[(2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,4R,5S)-4-[[(2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171360871 |
| Molecular Formula | C24H44F3N3O7 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | (3R,4R,5S)-4-[[(2S)-2-[[(2S)-2-(dimethylamino)-3-methylbutanoyl]amino]-3-methylbutanoyl]-methylamino]-3-methoxy-5-methylheptanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC[C@H](C)[C@H]([C@@H](CC(=O)O)OC)N(C)C(=O)[C@@H](NC(=O)[C@H](C(C)C)N(C)C)C(C)C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H43N3O5.C2HF3O2/c1-11-15(6)20(16(30-10)12-17(26)27)25(9)22(29)18(13(2)3)23-21(28)19(14(4)5)24(7)8;3-2(4,5)1(6)7/h13-16,18-20H,11-12H2,1-10H3,(H,23,28)(H,26,27);(H,6,7)/t15-,16+,18-,19-,20+;/m0./s1 |
| InChIKey | QUIQWXWGYURKKL-MEKJRQNISA-N |
| XLogP | 2.71 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |