C20H30O5 — CID 171362197
(E,2R,4S)-1-(4-methoxy-5-methyl-2-oxo-3H-furan-3-yl)-2,4-dimethyldodec-6-ene-1,5-dione (PubChem CID 171362197) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (E,2R,4S)-1-(4-methoxy-5-methyl-2-oxo-3H-furan-3-yl)-2,4-dimethyldodec-6-ene-1,5-dione.
| Compound Name | (E,2R,4S)-1-(4-methoxy-5-methyl-2-oxo-3H-furan-3-yl)-2,4-dimethyldodec-6-ene-1,5-dione |
|---|---|
| PubChem CID | 171362197 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (E,2R,4S)-1-(4-methoxy-5-methyl-2-oxo-3H-furan-3-yl)-2,4-dimethyldodec-6-ene-1,5-dione |
| SMILES | CCCCC/C=C/C(=O)[C@@H](C)C[C@@H](C)C(=O)C1C(=O)OC(C)=C1OC |
| InChI | InChI=1S/C20H30O5/c1-6-7-8-9-10-11-16(21)13(2)12-14(3)18(22)17-19(24-5)15(4)25-20(17)23/h10-11,13-14,17H,6-9,12H2,1-5H3/b11-10+/t13-,14+,17?/m0/s1 |
| InChIKey | CWJLRVUIPBVCFX-SVHSIPNMSA-N |
| XLogP | 3.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|