C35H37F4N3O3 — CID 171362479
(4aS,7aR)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide (PubChem CID 171362479) has the molecular formula C35H37F4N3O3 and a molecular weight of 623.69 g/mol. Its IUPAC name is (4aS,7aR)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide.
| Compound Name | (4aS,7aR)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171362479 |
| Molecular Formula | C35H37F4N3O3 |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.28 |
| IUPAC Name | (4aS,7aR)-2-[4-(cyclopentylamino)phenyl]-1-(2-fluoro-6-methylbenzoyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]-3,4,4a,5,7,7a-hexahydro-2H-furo[3,4-b]pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2C[C@@H]3COC[C@@H]3N(C(=O)c3c(C)cccc3F)C2c2ccc(NC3CCCC3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C35H37F4N3O3/c1-20-10-13-26(17-28(20)35(37,38)39)41-33(43)27-16-23-18-45-19-30(23)42(34(44)31-21(2)6-5-9-29(31)36)32(27)22-11-14-25(15-12-22)40-24-7-3-4-8-24/h5-6,9-15,17,23-24,27,30,32,40H,3-4,7-8,16,18-19H2,1-2H3,(H,41,43)/t23-,27?,30+,32?/m1/s1 |
| InChIKey | OSGRUDAWFSBDEN-SGAZRMQPSA-N |
| XLogP | 7.67 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |