C24H25F3N8O — CID 171362748
5-N-[[6-[8-(methoxymethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-methyl-3-pyridinyl]methyl]isoquinoline-1,5-diamine (PubChem CID 171362748) has the molecular formula C24H25F3N8O and a molecular weight of 498.51 g/mol. Its IUPAC name is 5-N-[[6-[8-(methoxymethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-methyl-3-pyridinyl]methyl]isoquinoline-1,5-diamine.
| Compound Name | 5-N-[[6-[8-(methoxymethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-methyl-3-pyridinyl]methyl]isoquinoline-1,5-diamine |
|---|---|
| PubChem CID | 171362748 |
| Molecular Formula | C24H25F3N8O |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 5-N-[[6-[8-(methoxymethyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-4-methyl-3-pyridinyl]methyl]isoquinoline-1,5-diamine |
| SMILES | COCC1c2nnc(C(F)(F)F)n2CCN1c1cc(C)c(CNc2cccc3c(N)nccc23)cn1 |
| InChI | InChI=1S/C24H25F3N8O/c1-14-10-20(34-8-9-35-22(19(34)13-36-2)32-33-23(35)24(25,26)27)31-12-15(14)11-30-18-5-3-4-17-16(18)6-7-29-21(17)28/h3-7,10,12,19,30H,8-9,11,13H2,1-2H3,(H2,28,29) |
| InChIKey | OKKPHMPYRLURBZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |