C30H39F3N6O — CID 171362941
7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-[2-[(E)-4,4,4-trifluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-6,8-dihydro-5H-quinoline-3-carbonitrile (PubChem CID 171362941) has the molecular formula C30H39F3N6O and a molecular weight of 556.68 g/mol. Its IUPAC name is 7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-[2-[(E)-4,4,4-trifluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-6,8-dihydro-5H-quinoline-3-carbonitrile.
| Compound Name | 7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-[2-[(E)-4,4,4-trifluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-6,8-dihydro-5H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 171362941 |
| Molecular Formula | C30H39F3N6O |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.31 |
| IUPAC Name | 7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-2-[2-[(E)-4,4,4-trifluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-6,8-dihydro-5H-quinoline-3-carbonitrile |
| SMILES | CC1CCC2NNCC2C1c1c(C#N)c(N2CCC3(CN(C(=O)/C=C/C(F)(F)F)C3)C2)nc2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C30H39F3N6O/c1-18-4-5-22-21(14-35-37-22)25(18)26-19-6-8-28(2,3)12-23(19)36-27(20(26)13-34)38-11-10-29(15-38)16-39(17-29)24(40)7-9-30(31,32)33/h7,9,18,21-22,25,35,37H,4-6,8,10-12,14-17H2,1-3H3/b9-7+ |
| InChIKey | BZXUKHCMJLQDFC-VQHVLOKHSA-N |
| XLogP | 4.23 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|