C30H40F2N6O — CID 171362942
2-[2-[(E)-4,4-difluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile (PubChem CID 171362942) has the molecular formula C30H40F2N6O and a molecular weight of 538.69 g/mol. Its IUPAC name is 2-[2-[(E)-4,4-difluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile.
| Compound Name | 2-[2-[(E)-4,4-difluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 171362942 |
| Molecular Formula | C30H40F2N6O |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.32 |
| IUPAC Name | 2-[2-[(E)-4,4-difluorobut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-7,7-dimethyl-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-6,8-dihydro-5H-quinoline-3-carbonitrile |
| SMILES | CC1CCC2NNCC2C1c1c(C#N)c(N2CCC3(CN(C(=O)/C=C/C(F)F)C3)C2)nc2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C30H40F2N6O/c1-18-4-5-22-21(14-34-36-22)26(18)27-19-8-9-29(2,3)12-23(19)35-28(20(27)13-33)37-11-10-30(15-37)16-38(17-30)25(39)7-6-24(31)32/h6-7,18,21-22,24,26,34,36H,4-5,8-12,14-17H2,1-3H3/b7-6+ |
| InChIKey | QLTKDNGSLYUCHG-VOTSOKGWSA-N |
| XLogP | 3.93 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|