C29H37F3N6O2 — CID 171362944
2-[2-[(E)-4-hydroxybut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-7-(trifluoromethyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 171362944) has the molecular formula C29H37F3N6O2 and a molecular weight of 558.65 g/mol. Its IUPAC name is 2-[2-[(E)-4-hydroxybut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-7-(trifluoromethyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[2-[(E)-4-hydroxybut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-7-(trifluoromethyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 171362944 |
| Molecular Formula | C29H37F3N6O2 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | 2-[2-[(E)-4-hydroxybut-2-enoyl]-2,7-diazaspiro[3.4]octan-7-yl]-4-(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl)-7-(trifluoromethyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CC1CCC2NNCC2C1c1c(C#N)c(N2CCC3(CN(C(=O)/C=C/CO)C3)C2)nc2c1CCC(C(F)(F)F)C2 |
| InChI | InChI=1S/C29H37F3N6O2/c1-17-4-7-22-21(13-34-36-22)25(17)26-19-6-5-18(29(30,31)32)11-23(19)35-27(20(26)12-33)37-9-8-28(14-37)15-38(16-28)24(40)3-2-10-39/h2-3,17-18,21-22,25,34,36,39H,4-11,13-16H2,1H3/b3-2+ |
| InChIKey | NWPVGDOCCBPVAA-NSCUHMNNSA-N |
| XLogP | 2.81 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|