About 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone
1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone (PubChem CID 171363036) has the molecular formula C7H6F3N5O
and a molecular weight of 233.15 g/mol. Its IUPAC name is 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone.
Molecular Properties
| Compound Name | 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone |
| PubChem CID | 171363036 |
| Molecular Formula | C7H6F3N5O |
| Molecular Weight | 233.15 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone |
| SMILES | [N-]=[N+]=NCCn1cc(C(=O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C7H6F3N5O/c8-7(9,10)6(16)5-3-13-15(4-5)2-1-12-14-11/h3-4H,1-2H2 |
| InChIKey | YHSUTKXGRXIJDE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 83.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone?
The IUPAC name of 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone (CID 171363036) is 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone.
What is the SMILES notation for 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone?
The canonical SMILES for 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone is [N-]=[N+]=NCCn1cc(C(=O)C(F)(F)F)cn1.
What is the InChIKey of 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone?
The InChIKey is YHSUTKXGRXIJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N5O/c8-7(9,10)6(16)5-3-13-15(4-5)2-1-12-14-11/h3-4H,1-2H2.
What are the key properties of 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone?
1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone has a molecular weight of 233.15 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2-azidoethyl)pyrazol-4-yl]-2,2,2-trifluoroethanone is sourced from PubChem (CID 171363036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).