C13H14N2O3S2 — CID 171363620
6-amino-4-(2,4-dimethoxyphenyl)-6,6a-dihydrodithiolo[4,3-b]pyrrol-5-one (PubChem CID 171363620) has the molecular formula C13H14N2O3S2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 6-amino-4-(2,4-dimethoxyphenyl)-6,6a-dihydrodithiolo[4,3-b]pyrrol-5-one.
| Compound Name | 6-amino-4-(2,4-dimethoxyphenyl)-6,6a-dihydrodithiolo[4,3-b]pyrrol-5-one |
|---|---|
| PubChem CID | 171363620 |
| Molecular Formula | C13H14N2O3S2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 6-amino-4-(2,4-dimethoxyphenyl)-6,6a-dihydrodithiolo[4,3-b]pyrrol-5-one |
| SMILES | COc1ccc(N2C(=O)C(N)C3SSC=C32)c(OC)c1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-17-7-3-4-8(10(5-7)18-2)15-9-6-19-20-12(9)11(14)13(15)16/h3-6,11-12H,14H2,1-2H3 |
| InChIKey | ZECAGLPWPIMBGM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|