C18H25N5O3S2 — CID 17136419
N-[4-(tert-butylsulfamoyl)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 17136419) has the molecular formula C18H25N5O3S2 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[4-(tert-butylsulfamoyl)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-[4-(tert-butylsulfamoyl)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 17136419 |
| Molecular Formula | C18H25N5O3S2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-[4-(tert-butylsulfamoyl)phenyl]-2-[(5-methyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | C=CCn1c(C)nnc1SCC(=O)Nc1ccc(S(=O)(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25N5O3S2/c1-6-11-23-13(2)20-21-17(23)27-12-16(24)19-14-7-9-15(10-8-14)28(25,26)22-18(3,4)5/h6-10,22H,1,11-12H2,2-5H3,(H,19,24) |
| InChIKey | PENWEYKFYAODDV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|