C20H23F2N3O4S2 — CID 171365646
N-[(1S,2R)-1-cyclopropyl-3-methylsulfonyl-2-sulfanylpropyl]-2-(1,1-difluoroethyl)-4-phenoxypyrimidine-5-carboxamide (PubChem CID 171365646) has the molecular formula C20H23F2N3O4S2 and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[(1S,2R)-1-cyclopropyl-3-methylsulfonyl-2-sulfanylpropyl]-2-(1,1-difluoroethyl)-4-phenoxypyrimidine-5-carboxamide.
| Compound Name | N-[(1S,2R)-1-cyclopropyl-3-methylsulfonyl-2-sulfanylpropyl]-2-(1,1-difluoroethyl)-4-phenoxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 171365646 |
| Molecular Formula | C20H23F2N3O4S2 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | N-[(1S,2R)-1-cyclopropyl-3-methylsulfonyl-2-sulfanylpropyl]-2-(1,1-difluoroethyl)-4-phenoxypyrimidine-5-carboxamide |
| SMILES | CC(F)(F)c1ncc(C(=O)N[C@@H](C2CC2)[C@@H](S)CS(C)(=O)=O)c(Oc2ccccc2)n1 |
| InChI | InChI=1S/C20H23F2N3O4S2/c1-20(21,22)19-23-10-14(18(25-19)29-13-6-4-3-5-7-13)17(26)24-16(12-8-9-12)15(30)11-31(2,27)28/h3-7,10,12,15-16,30H,8-9,11H2,1-2H3,(H,24,26)/t15-,16-/m0/s1 |
| InChIKey | VVWJFMXLJJRJQD-HOTGVXAUSA-N |
| XLogP | 3.23 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|