C10H3F7O — CID 171365766
4,5,6,7-tetrafluoro-1-(trifluoromethyl)-1,3-dihydroinden-2-one (PubChem CID 171365766) has the molecular formula C10H3F7O and a molecular weight of 272.12 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-1-(trifluoromethyl)-1,3-dihydroinden-2-one.
| Compound Name | 4,5,6,7-tetrafluoro-1-(trifluoromethyl)-1,3-dihydroinden-2-one |
|---|---|
| PubChem CID | 171365766 |
| Molecular Formula | C10H3F7O |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | 4,5,6,7-tetrafluoro-1-(trifluoromethyl)-1,3-dihydroinden-2-one |
| SMILES | O=C1Cc2c(F)c(F)c(F)c(F)c2C1C(F)(F)F |
| InChI | InChI=1S/C10H3F7O/c11-6-2-1-3(18)5(10(15,16)17)4(2)7(12)9(14)8(6)13/h5H,1H2 |
| InChIKey | BAOQEFUFOMWLCN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|